-
![C53H66N7O8PSI CAS NO.: 104992-55-4 Adenosine, N-Benzoyl-5 ′ -O- [bis (4-metoxyphenyl) fenilmetil] -2 ′-O- [1,1-dimethylethyl) Dimethylsilyl]-, 3-nynyil), 2-nyylilinyl)-2-n-nyyyl)-2-nynyil)-Nn-nyyylsyl), / 2-n-nyyyl), / 1,1-nyl- methylethyl) fosforamidit] (ACI)](https://cdn.globalso.com/nvchem/C53H66N7O8PSi.png)
C53H66N7O8PSI CAS NO.: 104992-55-4 Adenosine, N-Benzoyl-5 ′ -O- [bis (4-metoxyphenyl) fenilmetil] -2 ′-O- [1,1-dimethylethyl) Dimethylsilyl]-, 3-nynyil), 2-nyylilinyl)-2-n-nyyyl)-2-nynyil)-Nn-nyyylsyl), / 2-n-nyyyl), / 1,1-nyl- methylethyl) fosforamidit] (ACI)
Substance Detail CAS Registry Number 104992-55-4 Key Physical Properties Value Condition Molecular Weight 988.19 - pKa (Predicted) 7.87±0.43 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES N#CCCOP(OC1C(OC(N2C= NC=3C(= NC= NC32) NC (= O) C = 4C = CC = CC4) C1O [SI] (C) (C) C (C) (C) C) COC (C = 5C = CC = CC5) (C6 = CC = C (OC) C = C6) C7 = CC = C (OC) C = C7) N (C) C) C) C) C C (oc [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (o [si] (c (c) (c) c) (c) c) [c @@ h] (o1) n2c = 3c (n = c2) = c (nc (o) o) o = c = c = c = c = c = c (n (o) o = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c (n) c = c = c = c = c = c = c = c = c = c (n -
![C43H55N4O10p uridine, 5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -O- (2-methox yathyl)-5-methyl-, 3 ′-](https://cdn.globalso.com/nvchem/C43H55N4O10P-Uridine.png)
C43H55N4O10p uridine, 5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -O- (2-methox yathyl)-5-methyl-, 3 ′-
Detay sibstans ki sou CAS Rejis Nimewo 163878-63-5 H302 Key Fizik Pwopriyete Valè Kondisyon Molekilè Pwa 818.89-PKA (prevwa) N#CCCOP(OC1C(OC(N2C=C(C(=O)NC2=O)C)C1OCCOC)COC(C=3C=CC=CC3)(C4=CC=C(OC)C=C4)C5=CC=C(OC)C=C5)N(C(C)C)C(C)C Isomeric SMILES C (OC [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (occoc) [c @@ h] (o1) n2c (= o) nc (= o) c (c) = c2) (c3 = c = c (oc) c = c = c) (c = C (OC) C = C4) C5 = CC = CC = C5 INCHI INCHI = ... -
![C50H60N5O10P Cytidine, N-benzoyl-5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ -O- (2-methoxyethyl)- 5-methyl-, 3′ – [2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] (ACI)](https://cdn.globalso.com/nvchem/C50H60N5O10P-Cytidine.png)
C50H60N5O10P Cytidine, N-benzoyl-5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ -O- (2-methoxyethyl)- 5-methyl-, 3′ – [2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] (ACI)
Substance Detail CAS Registry Number 163759-94-2 Key Physical Properties Value Condition Molecular Weight 922.01 - pKa (Predicted) 8.59±0.40 Most Acidic Temp: 25 °C Other Names and Identifiers Canonical SMILES N#CCCOP(OC1C(OC(N2C=C(C(= NC2 = O) NC (= O) C = 3C = CC = CC3) C) C1OCCOC) COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C 6) N (C (C) C (OC [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (occoc) [c @@ h] (o1) n2c (= o) n = c (nc (= o) c3 = cc = c = c = C (OC) C = C4) (C5 = CC = C (OC) C ... -
![C47H60N7O10P Guanosine, 5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ -O-(2- methoxyethyl)-N-(2-methyl-1-oxopropyl)-, 3′ – [2-cyanoethyl N,N-bis (1-methylethyl)phosphoramidite] (ACI)](https://cdn.globalso.com/nvchem/C47H60N7O10P-Guanosine.png)
C47H60N7O10P Guanosine, 5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ -O-(2- methoxyethyl)-N-(2-methyl-1-oxopropyl)-, 3′ – [2-cyanoethyl N,N-bis (1-methylethyl)phosphoramidite] (ACI)
Detay sibstans ki sou CAS Rejis Nimewo 251647-55-9 H302 Pwopriyete Kle Fizik Kondisyon Molekilè Pwa 914.00-PKA (prevwa) 9.16 ± 0.20 Pifò asid tanperati: 25 ° C Lòt non ak idantifyan souri kanonyal N#CCCOP (OC1C (OC (N2C = Nc = 3c (= o) n = c (nc (= o) c (c) c) NC32) C1OCCOC) COC (C = 4C = CC = CC4) (C5 = CC = C (OC) C = C5) C6 = CC = C (OC) C = C6) N (C (C) C) C (C) C Isomer) C (C (C) C C (OC [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (occoc) [c @@ h] (o1) n2c3 = c (n = c2) c (= o) n = c (nc (c (c) c) = o) n3) (OC) C = C4) (C5 = CC = C (O ... -
![C50H58N7O9P Adenosine, N-benzoyl-5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ – O-(2-methoxyethyl)-, 3′ – [2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] (ACI)](https://cdn.globalso.com/nvchem/C50H58N7O9P-Adenosine.png)
C50H58N7O9P Adenosine, N-benzoyl-5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ – O-(2-methoxyethyl)-, 3′ – [2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] (ACI)
Detay sibstans ki sou CAS Rejis Nimewo 251647-53-7 H302 Pwopriyete Kle Fizik Kondisyon Molekilè Pwa 932.01-PKA (prevwa) 7.87 ± 0.43 Pifò asid tanperati: 25 ° C Lòt non ak idantifyan souri Canonical N#CCCOP (OC1C (OC (N2C = NC = NC = NC = NC = NC = NC = NY = NY (N2C = NC = NC = NC = NC = NC = NC = NY = NY (N2C = NC = NC = NC = NC = NC = N NY (N2C (N2C = NC = NC = NC = NC = N NY (OC1C (N2C = NC = NC = NC = NC = N NY (OC (OC (N2C = NC = NC = NC = NC = N NY (OC (OC (N2C = NC = NC = NC = NC ( NC32) NC (= O) C = 4C = CC = CC4) C1OCCOC) COC (C = 5C = CC = CC5) (C6 = CC = C (OC) C = C6) C7 = CC = C (OC) C = C7) N (C (C) C) C (C) C izomè C(OC[C@@H]1[C@@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@@H](OCCOC)[C@@H](O1)N2C=3C(N=C2)=C(NC(=O)C4=CC=CC=C4)N=CN3)(C5 =CC=C(OC)C=C5)(C... -
![C41H49FN5O8P cytidine, N-asetil-5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′-deoxy-2 ′ -fluoro-, 3 ′-2-cyanoethyl N, N-Bis (1-methyleth)](https://cdn.globalso.com/nvchem/C41H49FN5O8P-Cytidine.png)
C41H49FN5O8P cytidine, N-asetil-5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′-deoxy-2 ′ -fluoro-, 3 ′-2-cyanoethyl N, N-Bis (1-methyleth)
Detay sibstans ki sou CAS Rejis Nimewo 159414-99-0 Kle Fizik Pwopriyete Valè Kondisyon Molekilè Pwa 789.83-PKA (prevwa) 10.11 ± 0.20 Tan ki pi asid: 25 ° C lòt non ak idantifyan souri kanonyal N#CCCOP (OC1C (F) C (OC1COC (C = 2C = CC = CC2) (C3 = CC = C (OC) C = C3) C4 = CC = C (OC) C = C4) N5C = CC (= NC5 = O) NC (= O) C) N (C) C (oc [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (f) [c @@ h] (o1) n2c (= o) n = c (nc (c) = o) c = c2) (c3 = cc = c (oc) c = c) c) c (OC) C = C4) C5 = CC = CC = C5 pous pous ... -
![C39h46fn4o8p uridine, 5 ′ -o- [bis (4-methoxyphenyl) phenylmethyl] -2 ′ -deoxy-2 ′-fluoro-, 3 ′-[2-cyanoethyl N, N-bis (1-methylethyl) Phosphoramid] n, N-bis (1-methylethyl) fosphoramid], N-bis (1-methylethyl) fosphoramid], N-bis (1-methylethyl) fosphoramid.](https://cdn.globalso.com/nvchem/C39H46FN4O8P-Uridine.png)
C39h46fn4o8p uridine, 5 ′ -o- [bis (4-methoxyphenyl) phenylmethyl] -2 ′ -deoxy-2 ′-fluoro-, 3 ′-[2-cyanoethyl N, N-bis (1-methylethyl) Phosphoramid] n, N-bis (1-methylethyl) fosphoramid], N-bis (1-methylethyl) fosphoramid], N-bis (1-methylethyl) fosphoramid.
Detay sibstans ki sou CAS Rejis Nimewo 146954-75-8 Pwopriyete Kle Fizik Kondisyon Kondisyon Molekilè 748.78-PKA (prevwa) N#CCCOP (OC1C (F) C (OC1COC (C = 2C = CC = CC2) (C3 = CC = C (OC) C = C3) C4 = CC = C (OC) C = C4) N5C = CC (= O) NC5 = O) N (C (C ( C(OC[C@@H]1[C@@H](OP(N(C(C)C)C(C)C)OCCC#N)[C@@H](F)[C@@H](O1)N2C(=O)NC(=O)C=C2)(C3=CC=C(OC)C=C3)(C4=CC=C(OC)C= C4)C5=CC=CC=C5 Inchi inchi = 1S/C39H46FN4O8P/C1 -... -
![C44H53FN7O8 guanosine, 5 ′ -o- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -deoxy-2 ′-fluoro-n- (2-methyl-1-oxopropyl)-, 3 ′-[2-cyanoethyn N-1, N-Oxopropyl)-, 3 ′-](https://cdn.globalso.com/nvchem/C44H53FN7O8.png)
C44H53FN7O8 guanosine, 5 ′ -o- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -deoxy-2 ′-fluoro-n- (2-methyl-1-oxopropyl)-, 3 ′-[2-cyanoethyn N-1, N-Oxopropyl)-, 3 ′-
Detay sibstans ki sou CAS Rejis Nimewo 144089-97-4 Pwopriyete Kle Fizik Kondisyon Molekilè Pwa 857.91-PKA (prevwa) N#CCCOP (OC1C (F) C (OC1COC (C = 2C = CC = CC2) (C3 = CC = C (OC) C = C3) C4 = CC = C (OC) C = C4) N5C = NC = 6C (= O) N = C (NC (= O) C (C) C) NC6 se NC, C (C) C (C (C (C (C (C (C (= C) C (C) C (C) C (C) C (C) C (C) C (C (C (C (C (= C (= C (= C (= C (C (C (= C (= C (= O) C (C (C (C (= C (= O) C (C (C (C (= C (= C (= O) C (= C ( C (OC [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (f) [c @@ h] (o1) n2c3 = c (n = c2) c (= o) n = c (nc (c (c) c) = o) n3) (c = c = c (c (c (c) c) = o) n3) = C4) (C5 = CC = C (OC) C = C5) C6 = CC = ... -
![C47H51FN7O7P adenosine, N-Benzoyl-5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′-deoxy-2 ′ -fluoro-, 3 ′-2-cyanoethyl N, N-BIS (1-methyleth)](https://cdn.globalso.com/nvchem/C47H51FN7O7P-Adenosine.png)
C47H51FN7O7P adenosine, N-Benzoyl-5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′-deoxy-2 ′ -fluoro-, 3 ′-2-cyanoethyl N, N-BIS (1-methyleth)
Detay sibstans ki sou CAS Rejis Nimewo 136834-22-5 Pwopriyete Kle Fizik Kondisyon Kondisyon Molekilè 875.92-PKA (prevwa) 7.87 ± 0.43 tanperati ki pi asid: 25 ° C lòt non ak idantifyan souri kanonyal N#CCCOP (OC1C (F) C (OC1COC (C = 2C = CC = CC2) (C3 = CC = C (OC) C = C3) C4 = CC = C (OC) C = C4) N5C = NC = 6C (= NC = NC65) NC (= O) C = 7C) Souri C (OC [C @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (f) [c @@ h] (o1) n2c = 3c (n = c2) = c (nc (= o) c4 = cc = c = c4) n = n (OC) C = C5) (C6 = CC = C (OC) C = C ... -
![C42H52N5O9p cytidine, N-asetil-5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -O- methyl-, 3 ′-[2-cyanoethyl N, N-bis (1-methylethyl) phosphoramid] (1-) (1-methylethyl) fosforamik (1-methylethyl).](https://cdn.globalso.com/nvchem/C42H52N5O9P-Cytidine.png)
C42H52N5O9p cytidine, N-asetil-5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -O- methyl-, 3 ′-[2-cyanoethyl N, N-bis (1-methylethyl) phosphoramid] (1-) (1-methylethyl) fosforamik (1-methylethyl).
Detay sibstans ki sou CAS Rejis Nimewo 199593-09-4 Pwopriyete Kle Fizik Kondisyon Molekilè Pwa 801.87-PKA (prevwa) 10.18 ± 0.20 Tan ki pi asid: 25 ° C lòt non ak idantifyan kanonyal Smiles N#CCCOP (OC1C (OC (N2C = CC (= = = = = CC (= = = CC (= cc (= cc (= cc (= cc (= cc (= cc (= cc (= cc (= cc (= cc ( NC2 = O) NC (= O) C) C1OC) COC (C = 3C = CC = CC3) (C4 = CC = C (OC) C = C4) C5 = CC = C (OC) C (oc [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (oc) [c @@ h] (o1) n2c (= o) n = c (nc (c) = o) c = c2) (c3 = cc = c (oc) c = c) c) c) c = C (OC) C = C4) C5 = CC = CC = C5 INCHI INCHI = 1S/... -
![C40H49N4O9P uridine, 5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -o-methyl-, 3 ′-[2-cyanoethyl N, N-bis (1-methylethyl) fosforamidit] (ACI)) (ACI)](https://cdn.globalso.com/nvchem/C40H49N4O9P-Uridine.png)
C40H49N4O9P uridine, 5 ′ -O- [bis (4-methoxyphenyl) fenilmetil] -2 ′ -o-methyl-, 3 ′-[2-cyanoethyl N, N-bis (1-methylethyl) fosforamidit] (ACI)) (ACI)
Detay sibstans ki sou CAS Rejis Nimewo 110764-79-9 H335, H331, H319, H315, H311, H301+H311+H331, H301 Pwopriyete Kle Fizik Kondisyon Molekilè Pwa 760.81-PKA (prevwa N#CCCOP (OC1C (OC (N2C = CC (= O) NC2 = O) C1OC) COC (C = 3C = CC = CC3) (C4 = CC = C (OC) C = C4) C5 = CC = C (OC) C = C5) N (C (C ( C (OC [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (oc) [c @@ h] (o1) n2c (= o) nc (= o) c = c2) (c3 = cc = c (oc) c = c3) (c4 ... c4 ... -
![C45H56N7O9P Guanosine, 5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ -O-methyl- N-(2-methyl-1-oxopropyl)-, 3′ – [2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] (ACI)](https://cdn.globalso.com/nvchem/C45H56N7O9P.png)
C45H56N7O9P Guanosine, 5′ -O- [bis(4-methoxyphenyl)phenylmethyl]-2′ -O-methyl- N-(2-methyl-1-oxopropyl)-, 3′ – [2-cyanoethyl N,N-bis(1-methylethyl) phosphoramidite] (ACI)
Detay sibstans ki sou CAS Rejis Nimewo 150780-67-9 H303 Pwopriyete Kle Fizik Kondisyon Kondisyon Molekilè 869.94-PKA (prevwa) 9.16 ± 0.20 Pifò asid tanperati: 25 ° C Lòt non ak idantifyan N#CCCOP (OC1C (OC (N2C = Nc = 3c (= o) n = c (nc (= o) c (c) c) nc32) c1oc) coc (c = 4c = cc = cc4) (c5 = cc = c (oc) c = c5) c6 = cc = c (oc) c = c6) n (c (c C (oc [c @@ h] 1 [c @@ h] (op (n (c (c) c) c (c) c) occc#n) [c @@ h] (oc) [c @@ h] (o1) n2c3 = c (n = c2) c (= o) n = c (nc (c (c) c) = o) n3) (c = c = c (n (c (c) c) = o) n3) C = c4) (c5 = cc = c (oc) c = c5) c6 = cc = cc = c6 pous ...
